C18H18N2O4 — CID 46675118
(2-methylphenyl)methyl 4-(cyclopropylamino)-3-nitrobenzoate (PubChem CID 46675118) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is (2-methylphenyl)methyl 4-(cyclopropylamino)-3-nitrobenzoate.
| Compound Name | (2-methylphenyl)methyl 4-(cyclopropylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 46675118 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | (2-methylphenyl)methyl 4-(cyclopropylamino)-3-nitrobenzoate |
| SMILES | Cc1ccccc1COC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H18N2O4/c1-12-4-2-3-5-14(12)11-24-18(21)13-6-9-16(19-15-7-8-15)17(10-13)20(22)23/h2-6,9-10,15,19H,7-8,11H2,1H3 |
| InChIKey | UBVBUEKRNLZJBP-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|