C21H23N3O5 — CID 7650017
[2-oxo-2-(N-propan-2-ylanilino)ethyl] 4-(cyclopropylamino)-3-nitrobenzoate (PubChem CID 7650017) has the molecular formula C21H23N3O5 and a molecular weight of 397.43 g/mol. Its IUPAC name is [2-oxo-2-(N-propan-2-ylanilino)ethyl] 4-(cyclopropylamino)-3-nitrobenzoate.
| Compound Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7650017 |
| Molecular Formula | C21H23N3O5 |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.16 |
| IUPAC Name | [2-oxo-2-(N-propan-2-ylanilino)ethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
| SMILES | CC(C)N(C(=O)COC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1)c1ccccc1 |
| InChI | InChI=1S/C21H23N3O5/c1-14(2)23(17-6-4-3-5-7-17)20(25)13-29-21(26)15-8-11-18(22-16-9-10-16)19(12-15)24(27)28/h3-8,11-12,14,16,22H,9-10,13H2,1-2H3 |
| InChIKey | HUXVPXZVSWXHRA-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|