C23H25N3O5 — CID 9458719
[2-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate (PubChem CID 9458719) has the molecular formula C23H25N3O5 and a molecular weight of 423.47 g/mol. Its IUPAC name is [2-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate.
| Compound Name | [2-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 9458719 |
| Molecular Formula | C23H25N3O5 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [2-[methyl-[(1R)-1,2,3,4-tetrahydronaphthalen-1-yl]amino]-2-oxoethyl] 4-(cyclopropylamino)-3-nitrobenzoate |
| SMILES | CN(C(=O)COC(=O)c1ccc(NC2CC2)c([N+](=O)[O-])c1)[C@@H]1CCCc2ccccc21 |
| InChI | InChI=1S/C23H25N3O5/c1-25(20-8-4-6-15-5-2-3-7-18(15)20)22(27)14-31-23(28)16-9-12-19(24-17-10-11-17)21(13-16)26(29)30/h2-3,5,7,9,12-13,17,20,24H,4,6,8,10-11,14H2,1H3/t20-/m1/s1 |
| InChIKey | BQQOICAXJGKPRG-HXUWFJFHSA-N |
| XLogP | 3.86 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|