C21H22N2O5 — CID 60596461
[2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2-methyl-5-nitrobenzoate (PubChem CID 60596461) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2-methyl-5-nitrobenzoate.
| Compound Name | [2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2-methyl-5-nitrobenzoate |
|---|---|
| PubChem CID | 60596461 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [2-[methyl(1,2,3,4-tetrahydronaphthalen-1-yl)amino]-2-oxoethyl] 2-methyl-5-nitrobenzoate |
| SMILES | Cc1ccc([N+](=O)[O-])cc1C(=O)OCC(=O)N(C)C1CCCc2ccccc21 |
| InChI | InChI=1S/C21H22N2O5/c1-14-10-11-16(23(26)27)12-18(14)21(25)28-13-20(24)22(2)19-9-5-7-15-6-3-4-8-17(15)19/h3-4,6,8,10-12,19H,5,7,9,13H2,1-2H3 |
| InChIKey | ZIOPYXLRZXKXDZ-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|