C15H9Cl2F2N3O2 — CID 16624802
[1-(difluoromethyl)benzimidazol-2-yl]methyl 5,6-dichloropyridine-3-carboxylate (PubChem CID 16624802) has the molecular formula C15H9Cl2F2N3O2 and a molecular weight of 372.16 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 5,6-dichloropyridine-3-carboxylate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 5,6-dichloropyridine-3-carboxylate |
|---|---|
| PubChem CID | 16624802 |
| Molecular Formula | C15H9Cl2F2N3O2 |
| Molecular Weight | 372.16 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 5,6-dichloropyridine-3-carboxylate |
| SMILES | O=C(OCc1nc2ccccc2n1C(F)F)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H9Cl2F2N3O2/c16-9-5-8(6-20-13(9)17)14(23)24-7-12-21-10-3-1-2-4-11(10)22(12)15(18)19/h1-6,15H,7H2 |
| InChIKey | GBYPGGSZBGMNCQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.16 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|