C17H14F2N2O3 — CID 16624884
[1-(difluoromethyl)benzimidazol-2-yl]methyl 2-hydroxy-3-methylbenzoate (PubChem CID 16624884) has the molecular formula C17H14F2N2O3 and a molecular weight of 332.31 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-hydroxy-3-methylbenzoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-hydroxy-3-methylbenzoate |
|---|---|
| PubChem CID | 16624884 |
| Molecular Formula | C17H14F2N2O3 |
| Molecular Weight | 332.31 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-hydroxy-3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OCc2nc3ccccc3n2C(F)F)c1O |
| InChI | InChI=1S/C17H14F2N2O3/c1-10-5-4-6-11(15(10)22)16(23)24-9-14-20-12-7-2-3-8-13(12)21(14)17(18)19/h2-8,17,22H,9H2,1H3 |
| InChIKey | NRDAPQHMOSUPMT-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.31 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |