C18H16F2N2O3 — CID 16624713
[1-(difluoromethyl)benzimidazol-2-yl]methyl 2-(4-methoxyphenyl)acetate (PubChem CID 16624713) has the molecular formula C18H16F2N2O3 and a molecular weight of 346.33 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-(4-methoxyphenyl)acetate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-(4-methoxyphenyl)acetate |
|---|---|
| PubChem CID | 16624713 |
| Molecular Formula | C18H16F2N2O3 |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl 2-(4-methoxyphenyl)acetate |
| SMILES | COc1ccc(CC(=O)OCc2nc3ccccc3n2C(F)F)cc1 |
| InChI | InChI=1S/C18H16F2N2O3/c1-24-13-8-6-12(7-9-13)10-17(23)25-11-16-21-14-4-2-3-5-15(14)22(16)18(19)20/h2-9,18H,10-11H2,1H3 |
| InChIKey | YDVGZXJWLXIZPV-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |