C17H15F2N3O4 — CID 32739273
[1-(difluoromethyl)benzimidazol-2-yl]methyl (2S)-2-(furan-2-carbonylamino)propanoate (PubChem CID 32739273) has the molecular formula C17H15F2N3O4 and a molecular weight of 363.32 g/mol. Its IUPAC name is [1-(difluoromethyl)benzimidazol-2-yl]methyl (2S)-2-(furan-2-carbonylamino)propanoate.
| Compound Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl (2S)-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 32739273 |
| Molecular Formula | C17H15F2N3O4 |
| Molecular Weight | 363.32 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | [1-(difluoromethyl)benzimidazol-2-yl]methyl (2S)-2-(furan-2-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)c1ccco1)C(=O)OCc1nc2ccccc2n1C(F)F |
| InChI | InChI=1S/C17H15F2N3O4/c1-10(20-15(23)13-7-4-8-25-13)16(24)26-9-14-21-11-5-2-3-6-12(11)22(14)17(18)19/h2-8,10,17H,9H2,1H3,(H,20,23)/t10-/m0/s1 |
| InChIKey | VIBLEADDJFGWDD-JTQLQIEISA-N |
| XLogP | 2.89 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |