C16H15N5O4 — CID 24530129
(1-phenyltetrazol-5-yl)methyl (2S)-2-(furan-2-carbonylamino)propanoate (PubChem CID 24530129) has the molecular formula C16H15N5O4 and a molecular weight of 341.33 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl)methyl (2S)-2-(furan-2-carbonylamino)propanoate.
| Compound Name | (1-phenyltetrazol-5-yl)methyl (2S)-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 24530129 |
| Molecular Formula | C16H15N5O4 |
| Molecular Weight | 341.33 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (1-phenyltetrazol-5-yl)methyl (2S)-2-(furan-2-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)c1ccco1)C(=O)OCc1nnnn1-c1ccccc1 |
| InChI | InChI=1S/C16H15N5O4/c1-11(17-15(22)13-8-5-9-24-13)16(23)25-10-14-18-19-20-21(14)12-6-3-2-4-7-12/h2-9,11H,10H2,1H3,(H,17,22)/t11-/m0/s1 |
| InChIKey | BCKJIFJZTXFJTM-NSHDSACASA-N |
| XLogP | 1.12 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |