C21H17F2NO5 — CID 167980898
[3-fluoro-4-(2-fluorophenoxy)phenyl]methyl (2S)-2-(furan-2-carbonylamino)propanoate (PubChem CID 167980898) has the molecular formula C21H17F2NO5 and a molecular weight of 401.37 g/mol. Its IUPAC name is [3-fluoro-4-(2-fluorophenoxy)phenyl]methyl (2S)-2-(furan-2-carbonylamino)propanoate.
| Compound Name | [3-fluoro-4-(2-fluorophenoxy)phenyl]methyl (2S)-2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 167980898 |
| Molecular Formula | C21H17F2NO5 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | [3-fluoro-4-(2-fluorophenoxy)phenyl]methyl (2S)-2-(furan-2-carbonylamino)propanoate |
| SMILES | C[C@H](NC(=O)c1ccco1)C(=O)OCc1ccc(Oc2ccccc2F)c(F)c1 |
| InChI | InChI=1S/C21H17F2NO5/c1-13(24-20(25)19-7-4-10-27-19)21(26)28-12-14-8-9-18(16(23)11-14)29-17-6-3-2-5-15(17)22/h2-11,13H,12H2,1H3,(H,24,25)/t13-/m0/s1 |
| InChIKey | GMLILXQBXUIUQF-ZDUSSCGKSA-N |
| XLogP | 4.21 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |