C18H19FN2O4 — CID 8887523
(3-fluoro-4-methoxyphenyl)methyl (2S)-2-(phenylcarbamoylamino)propanoate (PubChem CID 8887523) has the molecular formula C18H19FN2O4 and a molecular weight of 346.36 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)methyl (2S)-2-(phenylcarbamoylamino)propanoate.
| Compound Name | (3-fluoro-4-methoxyphenyl)methyl (2S)-2-(phenylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 8887523 |
| Molecular Formula | C18H19FN2O4 |
| Molecular Weight | 346.36 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)methyl (2S)-2-(phenylcarbamoylamino)propanoate |
| SMILES | COc1ccc(COC(=O)[C@H](C)NC(=O)Nc2ccccc2)cc1F |
| InChI | InChI=1S/C18H19FN2O4/c1-12(20-18(23)21-14-6-4-3-5-7-14)17(22)25-11-13-8-9-16(24-2)15(19)10-13/h3-10,12H,11H2,1-2H3,(H2,20,21,23)/t12-/m0/s1 |
| InChIKey | LHFOQTIEZDDBGR-LBPRGKRZSA-N |
| XLogP | 3.09 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.36 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |