C16H17FN2O3 — CID 110895751
1-(3-fluoro-4-methoxyphenyl)-3-(2-hydroxy-1-phenylethyl)urea (PubChem CID 110895751) has the molecular formula C16H17FN2O3 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1-(3-fluoro-4-methoxyphenyl)-3-(2-hydroxy-1-phenylethyl)urea.
| Compound Name | 1-(3-fluoro-4-methoxyphenyl)-3-(2-hydroxy-1-phenylethyl)urea |
|---|---|
| PubChem CID | 110895751 |
| Molecular Formula | C16H17FN2O3 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 1-(3-fluoro-4-methoxyphenyl)-3-(2-hydroxy-1-phenylethyl)urea |
| SMILES | COc1ccc(NC(=O)NC(CO)c2ccccc2)cc1F |
| InChI | InChI=1S/C16H17FN2O3/c1-22-15-8-7-12(9-13(15)17)18-16(21)19-14(10-20)11-5-3-2-4-6-11/h2-9,14,20H,10H2,1H3,(H2,18,19,21) |
| InChIKey | WAANPSOYVOQOSW-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |