C15H13F3N2O2 — CID 111458987
1-(2-hydroxy-1-phenylethyl)-3-(3,4,5-trifluorophenyl)urea (PubChem CID 111458987) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is 1-(2-hydroxy-1-phenylethyl)-3-(3,4,5-trifluorophenyl)urea.
| Compound Name | 1-(2-hydroxy-1-phenylethyl)-3-(3,4,5-trifluorophenyl)urea |
|---|---|
| PubChem CID | 111458987 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 1-(2-hydroxy-1-phenylethyl)-3-(3,4,5-trifluorophenyl)urea |
| SMILES | O=C(Nc1cc(F)c(F)c(F)c1)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O2/c16-11-6-10(7-12(17)14(11)18)19-15(22)20-13(8-21)9-4-2-1-3-5-9/h1-7,13,21H,8H2,(H2,19,20,22) |
| InChIKey | BATOYYKTNUBYJY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|