C18H21FN2O3 — CID 110895772
1-[1-(5-fluoro-2-methoxyphenyl)ethyl]-3-(2-hydroxy-1-phenylethyl)urea (PubChem CID 110895772) has the molecular formula C18H21FN2O3 and a molecular weight of 332.38 g/mol. Its IUPAC name is 1-[1-(5-fluoro-2-methoxyphenyl)ethyl]-3-(2-hydroxy-1-phenylethyl)urea.
| Compound Name | 1-[1-(5-fluoro-2-methoxyphenyl)ethyl]-3-(2-hydroxy-1-phenylethyl)urea |
|---|---|
| PubChem CID | 110895772 |
| Molecular Formula | C18H21FN2O3 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | 1-[1-(5-fluoro-2-methoxyphenyl)ethyl]-3-(2-hydroxy-1-phenylethyl)urea |
| SMILES | COc1ccc(F)cc1C(C)NC(=O)NC(CO)c1ccccc1 |
| InChI | InChI=1S/C18H21FN2O3/c1-12(15-10-14(19)8-9-17(15)24-2)20-18(23)21-16(11-22)13-6-4-3-5-7-13/h3-10,12,16,22H,11H2,1-2H3,(H2,20,21,23) |
| InChIKey | QWSPDIBOVSPNJU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |