C15H15NO7 — CID 42936087
methyl 2-[2-(furan-2-carbonylamino)propanoyloxymethyl]furan-3-carboxylate (PubChem CID 42936087) has the molecular formula C15H15NO7 and a molecular weight of 321.29 g/mol. Its IUPAC name is methyl 2-[2-(furan-2-carbonylamino)propanoyloxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[2-(furan-2-carbonylamino)propanoyloxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 42936087 |
| Molecular Formula | C15H15NO7 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | methyl 2-[2-(furan-2-carbonylamino)propanoyloxymethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1COC(=O)C(C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C15H15NO7/c1-9(16-13(17)11-4-3-6-21-11)14(18)23-8-12-10(5-7-22-12)15(19)20-2/h3-7,9H,8H2,1-2H3,(H,16,17) |
| InChIKey | KBNCKMWWYRDFFD-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |