C8H9NO4 — CID 792932
(2S)-2-(furan-2-carbonylamino)propanoic acid (PubChem CID 792932) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is (2S)-2-(furan-2-carbonylamino)propanoic acid.
| Compound Name | (2S)-2-(furan-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 792932 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (2S)-2-(furan-2-carbonylamino)propanoic acid |
| SMILES | C[C@H](NC(=O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C8H9NO4/c1-5(8(11)12)9-7(10)6-3-2-4-13-6/h2-5H,1H3,(H,9,10)(H,11,12)/t5-/m0/s1 |
| InChIKey | VNYWJRJEGHPIQW-YFKPBYRVSA-N |
| XLogP | 0.48 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |