C13H19N3O4 — CID 47112949
N-[1-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 47112949) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is N-[1-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 47112949 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | N-[1-[[1-(ethylamino)-1-oxopropan-2-yl]amino]-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | CCNC(=O)C(C)NC(=O)C(C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C13H19N3O4/c1-4-14-11(17)8(2)15-12(18)9(3)16-13(19)10-6-5-7-20-10/h5-9H,4H2,1-3H3,(H,14,17)(H,15,18)(H,16,19) |
| InChIKey | YKTYAQINTSCHEH-UHFFFAOYSA-N |
| XLogP | 0.04 |
| TPSA | 100.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |