C10H15N3O3 — CID 119384374
N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]furan-2-carboxamide (PubChem CID 119384374) has the molecular formula C10H15N3O3 and a molecular weight of 225.25 g/mol. Its IUPAC name is N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]furan-2-carboxamide.
| Compound Name | N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 119384374 |
| Molecular Formula | C10H15N3O3 |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | N-[1-(2-aminoethylamino)-1-oxopropan-2-yl]furan-2-carboxamide |
| SMILES | CC(NC(=O)c1ccco1)C(=O)NCCN |
| InChI | InChI=1S/C10H15N3O3/c1-7(9(14)12-5-4-11)13-10(15)8-3-2-6-16-8/h2-3,6-7H,4-5,11H2,1H3,(H,12,14)(H,13,15) |
| InChIKey | KXOVKLHACCLVNK-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |