C19H29NO4 — CID 6423003
undec-10-enyl 2-(furan-2-carbonylamino)propanoate (PubChem CID 6423003) has the molecular formula C19H29NO4 and a molecular weight of 335.44 g/mol. Its IUPAC name is undec-10-enyl 2-(furan-2-carbonylamino)propanoate.
| Compound Name | undec-10-enyl 2-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 6423003 |
| Molecular Formula | C19H29NO4 |
| Molecular Weight | 335.44 g/mol |
| Exact Mass | 335.21 |
| IUPAC Name | undec-10-enyl 2-(furan-2-carbonylamino)propanoate |
| SMILES | C=CCCCCCCCCCOC(=O)C(C)NC(=O)c1ccco1 |
| InChI | InChI=1S/C19H29NO4/c1-3-4-5-6-7-8-9-10-11-14-24-19(22)16(2)20-18(21)17-13-12-15-23-17/h3,12-13,15-16H,1,4-11,14H2,2H3,(H,20,21) |
| InChIKey | UYLBVCQGXDUGPP-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|