C19H29NO2 — CID 596192
dec-9-enyl N-(1-phenylethyl)carbamate (PubChem CID 596192) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is dec-9-enyl N-(1-phenylethyl)carbamate.
| Compound Name | dec-9-enyl N-(1-phenylethyl)carbamate |
|---|---|
| PubChem CID | 596192 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | dec-9-enyl N-(1-phenylethyl)carbamate |
| SMILES | C=CCCCCCCCCOC(=O)NC(C)c1ccccc1 |
| InChI | InChI=1S/C19H29NO2/c1-3-4-5-6-7-8-9-13-16-22-19(21)20-17(2)18-14-11-10-12-15-18/h3,10-12,14-15,17H,1,4-9,13,16H2,2H3,(H,20,21) |
| InChIKey | JSMWQVJQAWYZNS-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|