C21H39NO4 — CID 20837345
undec-10-enyl (2S)-3-methyl-2-(propoxycarbonylamino)pentanoate (PubChem CID 20837345) has the molecular formula C21H39NO4 and a molecular weight of 369.55 g/mol. Its IUPAC name is undec-10-enyl (2S)-3-methyl-2-(propoxycarbonylamino)pentanoate.
| Compound Name | undec-10-enyl (2S)-3-methyl-2-(propoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 20837345 |
| Molecular Formula | C21H39NO4 |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | undec-10-enyl (2S)-3-methyl-2-(propoxycarbonylamino)pentanoate |
| SMILES | C=CCCCCCCCCCOC(=O)[C@@H](NC(=O)OCCC)C(C)CC |
| InChI | InChI=1S/C21H39NO4/c1-5-8-9-10-11-12-13-14-15-17-25-20(23)19(18(4)7-3)22-21(24)26-16-6-2/h5,18-19H,1,6-17H2,2-4H3,(H,22,24)/t18?,19-/m0/s1 |
| InChIKey | MEOXTFHGJJEGDY-GGYWPGCISA-N |
| XLogP | 5.39 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|