C17H31ClN2O3 — CID 90089497
dec-9-enyl N-[1-(chloroamino)-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 90089497) has the molecular formula C17H31ClN2O3 and a molecular weight of 346.90 g/mol. Its IUPAC name is dec-9-enyl N-[1-(chloroamino)-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | dec-9-enyl N-[1-(chloroamino)-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 90089497 |
| Molecular Formula | C17H31ClN2O3 |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | dec-9-enyl N-[1-(chloroamino)-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C=CCCCCCCCCOC(=O)NC(C(=O)NCl)C(C)CC |
| InChI | InChI=1S/C17H31ClN2O3/c1-4-6-7-8-9-10-11-12-13-23-17(22)19-15(14(3)5-2)16(21)20-18/h4,14-15H,1,5-13H2,2-3H3,(H,19,22)(H,20,21) |
| InChIKey | JBWVQDPEGDINMV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|