About hept-6-enyl N-ethenylcarbamate
hept-6-enyl N-ethenylcarbamate (PubChem CID 166881876) has the molecular formula C10H17NO2
and a molecular weight of 183.25 g/mol. Its IUPAC name is hept-6-enyl N-ethenylcarbamate.
Molecular Properties
| Compound Name | hept-6-enyl N-ethenylcarbamate |
| PubChem CID | 166881876 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | hept-6-enyl N-ethenylcarbamate |
| SMILES | C=CCCCCCOC(=O)NC=C |
| InChI | InChI=1S/C10H17NO2/c1-3-5-6-7-8-9-13-10(12)11-4-2/h3-4H,1-2,5-9H2,(H,11,12) |
| InChIKey | FWQCBCRZXBLSHK-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hept-6-enyl N-ethenylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hept-6-enyl N-ethenylcarbamate?
The IUPAC name of hept-6-enyl N-ethenylcarbamate (CID 166881876) is hept-6-enyl N-ethenylcarbamate.
What is the SMILES notation for hept-6-enyl N-ethenylcarbamate?
The canonical SMILES for hept-6-enyl N-ethenylcarbamate is C=CCCCCCOC(=O)NC=C.
What is the InChIKey of hept-6-enyl N-ethenylcarbamate?
The InChIKey is FWQCBCRZXBLSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2/c1-3-5-6-7-8-9-13-10(12)11-4-2/h3-4H,1-2,5-9H2,(H,11,12).
What are the key properties of hept-6-enyl N-ethenylcarbamate?
hept-6-enyl N-ethenylcarbamate has a molecular weight of 183.25 g/mol, XLogP of 2.60, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hept-6-enyl N-ethenylcarbamate is sourced from PubChem (CID 166881876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).