About propyl N-ethenylcarbamate;silane
propyl N-ethenylcarbamate;silane (PubChem CID 174610345) has the molecular formula C6H15NO2Si
and a molecular weight of 161.28 g/mol. Its IUPAC name is propyl N-ethenylcarbamate;silane.
Molecular Properties
| Compound Name | propyl N-ethenylcarbamate;silane |
| PubChem CID | 174610345 |
| Molecular Formula | C6H15NO2Si |
| Molecular Weight | 161.28 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | propyl N-ethenylcarbamate;silane |
| SMILES | C=CNC(=O)OCCC.[SiH4] |
| InChI | InChI=1S/C6H11NO2.H4Si/c1-3-5-9-6(8)7-4-2;/h4H,2-3,5H2,1H3,(H,7,8);1H4 |
| InChIKey | MNJKWXQUEFDFIZ-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze propyl N-ethenylcarbamate;silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl N-ethenylcarbamate;silane?
The IUPAC name of propyl N-ethenylcarbamate;silane (CID 174610345) is propyl N-ethenylcarbamate;silane.
What is the SMILES notation for propyl N-ethenylcarbamate;silane?
The canonical SMILES for propyl N-ethenylcarbamate;silane is C=CNC(=O)OCCC.[SiH4].
What is the InChIKey of propyl N-ethenylcarbamate;silane?
The InChIKey is MNJKWXQUEFDFIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NO2.H4Si/c1-3-5-9-6(8)7-4-2;/h4H,2-3,5H2,1H3,(H,7,8);1H4.
What are the key properties of propyl N-ethenylcarbamate;silane?
propyl N-ethenylcarbamate;silane has a molecular weight of 161.28 g/mol, XLogP of -0.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propyl N-ethenylcarbamate;silane is sourced from PubChem (CID 174610345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).