About ethane;propyl N-methylcarbamate
ethane;propyl N-methylcarbamate (PubChem CID 142560404) has the molecular formula C7H17NO2
and a molecular weight of 147.22 g/mol. Its IUPAC name is ethane;propyl N-methylcarbamate.
Molecular Properties
| Compound Name | ethane;propyl N-methylcarbamate |
| PubChem CID | 142560404 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | ethane;propyl N-methylcarbamate |
| SMILES | CC.CCCOC(=O)NC |
| InChI | InChI=1S/C5H11NO2.C2H6/c1-3-4-8-5(7)6-2;1-2/h3-4H2,1-2H3,(H,6,7);1-2H3 |
| InChIKey | MMMLKHHAWGQGBF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;propyl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;propyl N-methylcarbamate?
The IUPAC name of ethane;propyl N-methylcarbamate (CID 142560404) is ethane;propyl N-methylcarbamate.
What is the SMILES notation for ethane;propyl N-methylcarbamate?
The canonical SMILES for ethane;propyl N-methylcarbamate is CC.CCCOC(=O)NC.
What is the InChIKey of ethane;propyl N-methylcarbamate?
The InChIKey is MMMLKHHAWGQGBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C2H6/c1-3-4-8-5(7)6-2;1-2/h3-4H2,1-2H3,(H,6,7);1-2H3.
What are the key properties of ethane;propyl N-methylcarbamate?
ethane;propyl N-methylcarbamate has a molecular weight of 147.22 g/mol, XLogP of 1.78, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;propyl N-methylcarbamate is sourced from PubChem (CID 142560404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).