About ethyl N-methylcarbamate;formaldehyde
ethyl N-methylcarbamate;formaldehyde (PubChem CID 160650405) has the molecular formula C5H11NO3
and a molecular weight of 133.15 g/mol. Its IUPAC name is ethyl N-methylcarbamate;formaldehyde.
Molecular Properties
| Compound Name | ethyl N-methylcarbamate;formaldehyde |
| PubChem CID | 160650405 |
| Molecular Formula | C5H11NO3 |
| Molecular Weight | 133.15 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | ethyl N-methylcarbamate;formaldehyde |
| SMILES | C=O.CCOC(=O)NC |
| InChI | InChI=1S/C4H9NO2.CH2O/c1-3-7-4(6)5-2;1-2/h3H2,1-2H3,(H,5,6);1H2 |
| InChIKey | RKIMTPJLXSOBKZ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.15 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl N-methylcarbamate;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-methylcarbamate;formaldehyde?
The IUPAC name of ethyl N-methylcarbamate;formaldehyde (CID 160650405) is ethyl N-methylcarbamate;formaldehyde.
What is the SMILES notation for ethyl N-methylcarbamate;formaldehyde?
The canonical SMILES for ethyl N-methylcarbamate;formaldehyde is C=O.CCOC(=O)NC.
What is the InChIKey of ethyl N-methylcarbamate;formaldehyde?
The InChIKey is RKIMTPJLXSOBKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.CH2O/c1-3-7-4(6)5-2;1-2/h3H2,1-2H3,(H,5,6);1H2.
What are the key properties of ethyl N-methylcarbamate;formaldehyde?
ethyl N-methylcarbamate;formaldehyde has a molecular weight of 133.15 g/mol, XLogP of 0.18, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-methylcarbamate;formaldehyde is sourced from PubChem (CID 160650405), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).