C12H23N3O6 — CID 59137176
2,2-bis(methylcarbamoyloxymethyl)butyl N-methylcarbamate (PubChem CID 59137176) has the molecular formula C12H23N3O6 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2,2-bis(methylcarbamoyloxymethyl)butyl N-methylcarbamate.
| Compound Name | 2,2-bis(methylcarbamoyloxymethyl)butyl N-methylcarbamate |
|---|---|
| PubChem CID | 59137176 |
| Molecular Formula | C12H23N3O6 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2,2-bis(methylcarbamoyloxymethyl)butyl N-methylcarbamate |
| SMILES | CCC(COC(=O)NC)(COC(=O)NC)COC(=O)NC |
| InChI | InChI=1S/C12H23N3O6/c1-5-12(6-19-9(16)13-2,7-20-10(17)14-3)8-21-11(18)15-4/h5-8H2,1-4H3,(H,13,16)(H,14,17)(H,15,18) |
| InChIKey | LIERWKPGDLEZSG-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|