C15H28N4O8 — CID 145215020
[2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)-3-(propan-2-ylcarbamoyloxy)propyl] N-ethylcarbamate (PubChem CID 145215020) has the molecular formula C15H28N4O8 and a molecular weight of 392.41 g/mol. Its IUPAC name is [2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)-3-(propan-2-ylcarbamoyloxy)propyl] N-ethylcarbamate.
| Compound Name | [2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)-3-(propan-2-ylcarbamoyloxy)propyl] N-ethylcarbamate |
|---|---|
| PubChem CID | 145215020 |
| Molecular Formula | C15H28N4O8 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | [2-(carbamoyloxymethyl)-2-(methylcarbamoyloxymethyl)-3-(propan-2-ylcarbamoyloxy)propyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(COC(N)=O)(COC(=O)NC)COC(=O)NC(C)C |
| InChI | InChI=1S/C15H28N4O8/c1-5-18-13(22)26-8-15(6-24-11(16)20,7-25-12(21)17-4)9-27-14(23)19-10(2)3/h10H,5-9H2,1-4H3,(H2,16,20)(H,17,21)(H,18,22)(H,19,23) |
| InChIKey | ZXBNITTWYNYELG-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|