C14H28N2O6 — CID 134348106
acetic acid;[2-(carbamoyloxymethyl)-2-methylpentyl] N-propan-2-ylcarbamate (PubChem CID 134348106) has the molecular formula C14H28N2O6 and a molecular weight of 320.39 g/mol. Its IUPAC name is acetic acid;[2-(carbamoyloxymethyl)-2-methylpentyl] N-propan-2-ylcarbamate.
| Compound Name | acetic acid;[2-(carbamoyloxymethyl)-2-methylpentyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 134348106 |
| Molecular Formula | C14H28N2O6 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | acetic acid;[2-(carbamoyloxymethyl)-2-methylpentyl] N-propan-2-ylcarbamate |
| SMILES | CC(=O)O.CCCC(C)(COC(N)=O)COC(=O)NC(C)C |
| InChI | InChI=1S/C12H24N2O4.C2H4O2/c1-5-6-12(4,7-17-10(13)15)8-18-11(16)14-9(2)3;1-2(3)4/h9H,5-8H2,1-4H3,(H2,13,15)(H,14,16);1H3,(H,3,4) |
| InChIKey | FIRWEBFYXLUEKP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |