C11H21NO3 — CID 131667708
[2-(hydroxymethyl)-2-methylpent-4-enyl] N-propan-2-ylcarbamate (PubChem CID 131667708) has the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. Its IUPAC name is [2-(hydroxymethyl)-2-methylpent-4-enyl] N-propan-2-ylcarbamate.
| Compound Name | [2-(hydroxymethyl)-2-methylpent-4-enyl] N-propan-2-ylcarbamate |
|---|---|
| PubChem CID | 131667708 |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | [2-(hydroxymethyl)-2-methylpent-4-enyl] N-propan-2-ylcarbamate |
| SMILES | C=CCC(C)(CO)COC(=O)NC(C)C |
| InChI | InChI=1S/C11H21NO3/c1-5-6-11(4,7-13)8-15-10(14)12-9(2)3/h5,9,13H,1,6-8H2,2-4H3,(H,12,14) |
| InChIKey | OUDXTZMAYGENMF-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|