C16H29NO5 — CID 172708004
[2-(2,2-dimethylpropanoyloxymethyl)-2-(hydroxyamino)pent-4-enyl] 2,2-dimethylpropanoate (PubChem CID 172708004) has the molecular formula C16H29NO5 and a molecular weight of 315.41 g/mol. Its IUPAC name is [2-(2,2-dimethylpropanoyloxymethyl)-2-(hydroxyamino)pent-4-enyl] 2,2-dimethylpropanoate.
| Compound Name | [2-(2,2-dimethylpropanoyloxymethyl)-2-(hydroxyamino)pent-4-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 172708004 |
| Molecular Formula | C16H29NO5 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | [2-(2,2-dimethylpropanoyloxymethyl)-2-(hydroxyamino)pent-4-enyl] 2,2-dimethylpropanoate |
| SMILES | C=CCC(COC(=O)C(C)(C)C)(COC(=O)C(C)(C)C)NO |
| InChI | InChI=1S/C16H29NO5/c1-8-9-16(17-20,10-21-12(18)14(2,3)4)11-22-13(19)15(5,6)7/h8,17,20H,1,9-11H2,2-7H3 |
| InChIKey | DWAKYHSMUWMQDQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|