C12H26N2O5S — CID 21149682
carbamic acid;[2-(hydroxymethyl)-2-methylpentyl] N-propan-2-ylsulfanylcarbamate (PubChem CID 21149682) has the molecular formula C12H26N2O5S and a molecular weight of 310.42 g/mol. Its IUPAC name is carbamic acid;[2-(hydroxymethyl)-2-methylpentyl] N-propan-2-ylsulfanylcarbamate.
| Compound Name | carbamic acid;[2-(hydroxymethyl)-2-methylpentyl] N-propan-2-ylsulfanylcarbamate |
|---|---|
| PubChem CID | 21149682 |
| Molecular Formula | C12H26N2O5S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.16 |
| IUPAC Name | carbamic acid;[2-(hydroxymethyl)-2-methylpentyl] N-propan-2-ylsulfanylcarbamate |
| SMILES | CCCC(C)(CO)COC(=O)NSC(C)C.NC(=O)O |
| InChI | InChI=1S/C11H23NO3S.CH3NO2/c1-5-6-11(4,7-13)8-15-10(14)12-16-9(2)3;2-1(3)4/h9,13H,5-8H2,1-4H3,(H,12,14);2H2,(H,3,4) |
| InChIKey | JHWBSRXGDHGTTJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|