About [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate
[3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate (PubChem CID 58493133) has the molecular formula C10H20N2O4
and a molecular weight of 232.28 g/mol. Its IUPAC name is [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate.
Molecular Properties
| Compound Name | [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate |
| PubChem CID | 58493133 |
| Molecular Formula | C10H20N2O4 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.14 |
| IUPAC Name | [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate |
| SMILES | CCNC(=O)OCC(C)COC(=O)NCC |
| InChI | InChI=1S/C10H20N2O4/c1-4-11-9(13)15-6-8(3)7-16-10(14)12-5-2/h8H,4-7H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | OYPKHBPLVJHIRO-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 76.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | 199 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate?
The IUPAC name of [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate (CID 58493133) is [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate.
What is the SMILES notation for [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate?
The canonical SMILES for [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate is CCNC(=O)OCC(C)COC(=O)NCC.
What is the InChIKey of [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate?
The InChIKey is OYPKHBPLVJHIRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O4/c1-4-11-9(13)15-6-8(3)7-16-10(14)12-5-2/h8H,4-7H2,1-3H3,(H,11,13)(H,12,14).
What are the key properties of [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate?
[3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate has a molecular weight of 232.28 g/mol, XLogP of 1.20, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(ethylcarbamoyloxy)-2-methylpropyl] N-ethylcarbamate is sourced from PubChem (CID 58493133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).