C11H24N2O4 — CID 158264947
4-(ethylcarbamoyloxy)butyl N-ethylcarbamate;methane (PubChem CID 158264947) has the molecular formula C11H24N2O4 and a molecular weight of 248.32 g/mol. Its IUPAC name is 4-(ethylcarbamoyloxy)butyl N-ethylcarbamate;methane.
| Compound Name | 4-(ethylcarbamoyloxy)butyl N-ethylcarbamate;methane |
|---|---|
| PubChem CID | 158264947 |
| Molecular Formula | C11H24N2O4 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 4-(ethylcarbamoyloxy)butyl N-ethylcarbamate;methane |
| SMILES | C.CCNC(=O)OCCCCOC(=O)NCC |
| InChI | InChI=1S/C10H20N2O4.CH4/c1-3-11-9(13)15-7-5-6-8-16-10(14)12-4-2;/h3-8H2,1-2H3,(H,11,13)(H,12,14);1H4 |
| InChIKey | GIIAQKOQFJUNQZ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|