C9H21NO5Si — CID 141299564
3-trimethoxysilylpropyl N-ethylcarbamate (PubChem CID 141299564) has the molecular formula C9H21NO5Si and a molecular weight of 251.35 g/mol. Its IUPAC name is 3-trimethoxysilylpropyl N-ethylcarbamate.
| Compound Name | 3-trimethoxysilylpropyl N-ethylcarbamate |
|---|---|
| PubChem CID | 141299564 |
| Molecular Formula | C9H21NO5Si |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | 3-trimethoxysilylpropyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C9H21NO5Si/c1-5-10-9(11)15-7-6-8-16(12-2,13-3)14-4/h5-8H2,1-4H3,(H,10,11) |
| InChIKey | YEOKONCNBWNRRE-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|