C17H33NO7Si — CID 171791213
6-(3-trimethoxysilylpropylcarbamoyloxy)hexyl 2-methylprop-2-enoate (PubChem CID 171791213) has the molecular formula C17H33NO7Si and a molecular weight of 391.54 g/mol. Its IUPAC name is 6-(3-trimethoxysilylpropylcarbamoyloxy)hexyl 2-methylprop-2-enoate.
| Compound Name | 6-(3-trimethoxysilylpropylcarbamoyloxy)hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 171791213 |
| Molecular Formula | C17H33NO7Si |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | 6-(3-trimethoxysilylpropylcarbamoyloxy)hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCOC(=O)NCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C17H33NO7Si/c1-15(2)16(19)24-12-8-6-7-9-13-25-17(20)18-11-10-14-26(21-3,22-4)23-5/h1,6-14H2,2-5H3,(H,18,20) |
| InChIKey | GZLJRGBUHZADJZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|