C13H21NO6 — CID 143847677
6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexanoic acid (PubChem CID 143847677) has the molecular formula C13H21NO6 and a molecular weight of 287.31 g/mol. Its IUPAC name is 6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexanoic acid.
| Compound Name | 6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexanoic acid |
|---|---|
| PubChem CID | 143847677 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 6-[2-(2-methylprop-2-enoyloxy)ethoxycarbonylamino]hexanoic acid |
| SMILES | C=C(C)C(=O)OCCOC(=O)NCCCCCC(=O)O |
| InChI | InChI=1S/C13H21NO6/c1-10(2)12(17)19-8-9-20-13(18)14-7-5-3-4-6-11(15)16/h1,3-9H2,2H3,(H,14,18)(H,15,16) |
| InChIKey | YJGYUODUBKUUQP-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|