C15H25NO5 — CID 118143504
8-[3-(2-methylprop-2-enoyloxy)propylamino]-8-oxooctanoic acid (PubChem CID 118143504) has the molecular formula C15H25NO5 and a molecular weight of 299.37 g/mol. Its IUPAC name is 8-[3-(2-methylprop-2-enoyloxy)propylamino]-8-oxooctanoic acid.
| Compound Name | 8-[3-(2-methylprop-2-enoyloxy)propylamino]-8-oxooctanoic acid |
|---|---|
| PubChem CID | 118143504 |
| Molecular Formula | C15H25NO5 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 8-[3-(2-methylprop-2-enoyloxy)propylamino]-8-oxooctanoic acid |
| SMILES | C=C(C)C(=O)OCCCNC(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C15H25NO5/c1-12(2)15(20)21-11-7-10-16-13(17)8-5-3-4-6-9-14(18)19/h1,3-11H2,2H3,(H,16,17)(H,18,19) |
| InChIKey | GTCBJOZYWYBZPQ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|