C24H43NO3 — CID 132559697
2-[[(Z)-octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 132559697) has the molecular formula C24H43NO3 and a molecular weight of 393.61 g/mol. Its IUPAC name is 2-[[(Z)-octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(Z)-octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 132559697 |
| Molecular Formula | C24H43NO3 |
| Molecular Weight | 393.61 g/mol |
| Exact Mass | 393.32 |
| IUPAC Name | 2-[[(Z)-octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C24H43NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-23(26)25-20-21-28-24(27)22(2)3/h11-12H,2,4-10,13-21H2,1,3H3,(H,25,26)/b12-11- |
| InChIKey | SMUDRRVSYHQMRA-QXMHVHEDSA-N |
| XLogP | 6.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|