C28H47NO5 — CID 102166829
2-[[(E)-12-(2-methylprop-2-enoyloxy)octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate (PubChem CID 102166829) has the molecular formula C28H47NO5 and a molecular weight of 477.69 g/mol. Its IUPAC name is 2-[[(E)-12-(2-methylprop-2-enoyloxy)octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[[(E)-12-(2-methylprop-2-enoyloxy)octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102166829 |
| Molecular Formula | C28H47NO5 |
| Molecular Weight | 477.69 g/mol |
| Exact Mass | 477.35 |
| IUPAC Name | 2-[[(E)-12-(2-methylprop-2-enoyloxy)octadec-9-enoyl]amino]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)CCCCCCC/C=C/CC(CCCCCC)OC(=O)C(=C)C |
| InChI | InChI=1S/C28H47NO5/c1-6-7-8-15-18-25(34-28(32)24(4)5)19-16-13-11-9-10-12-14-17-20-26(30)29-21-22-33-27(31)23(2)3/h13,16,25H,2,4,6-12,14-15,17-22H2,1,3,5H3,(H,29,30)/b16-13+ |
| InChIKey | PFMBJPJYCNBYEH-DTQAZKPQSA-N |
| XLogP | 6.36 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.69 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|