About 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate
2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate (PubChem CID 88523460) has the molecular formula C25H46N2O3
and a molecular weight of 422.65 g/mol. Its IUPAC name is 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate.
Molecular Properties
| Compound Name | 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate |
| PubChem CID | 88523460 |
| Molecular Formula | C25H46N2O3 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.35 |
| IUPAC Name | 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate |
| SMILES | C=C(CCCCCCCCC/C=C\CCCCCCCC)C(=O)OCCNC(N)=O |
| InChI | InChI=1S/C25H46N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(2)24(28)30-22-21-27-25(26)29/h10-11H,2-9,12-22H2,1H3,(H3,26,27,29)/b11-10- |
| InChIKey | ZEACDPDBJPWHNN-KHPPLWFESA-N |
| XLogP | 6.57 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate?
The IUPAC name of 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate (CID 88523460) is 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate.
What is the SMILES notation for 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate?
The canonical SMILES for 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate is C=C(CCCCCCCCC/C=C\CCCCCCCC)C(=O)OCCNC(N)=O.
What is the InChIKey of 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate?
The InChIKey is ZEACDPDBJPWHNN-KHPPLWFESA-N. The full InChI is InChI=1S/C25H46N2O3/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-23(2)24(28)30-22-21-27-25(26)29/h10-11H,2-9,12-22H2,1H3,(H3,26,27,29)/b11-10-.
What are the key properties of 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate?
2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate has a molecular weight of 422.65 g/mol, XLogP of 6.57, 21 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(carbamoylamino)ethyl (Z)-2-methylidenehenicos-12-enoate is sourced from PubChem (CID 88523460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).