About nonyl 2-methylidenedodecanoate;prop-2-enoic acid
nonyl 2-methylidenedodecanoate;prop-2-enoic acid (PubChem CID 135390219) has the molecular formula C25H46O4
and a molecular weight of 410.64 g/mol. Its IUPAC name is nonyl 2-methylidenedodecanoate;prop-2-enoic acid.
Molecular Properties
| Compound Name | nonyl 2-methylidenedodecanoate;prop-2-enoic acid |
| PubChem CID | 135390219 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | nonyl 2-methylidenedodecanoate;prop-2-enoic acid |
| SMILES | C=C(CCCCCCCCCC)C(=O)OCCCCCCCCC.C=CC(=O)O |
| InChI | InChI=1S/C22H42O2.C3H4O2/c1-4-6-8-10-12-13-15-17-19-21(3)22(23)24-20-18-16-14-11-9-7-5-2;1-2-3(4)5/h3-20H2,1-2H3;2H,1H2,(H,4,5) |
| InChIKey | WRKSERVONUTDJX-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze nonyl 2-methylidenedodecanoate;prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonyl 2-methylidenedodecanoate;prop-2-enoic acid?
The IUPAC name of nonyl 2-methylidenedodecanoate;prop-2-enoic acid (CID 135390219) is nonyl 2-methylidenedodecanoate;prop-2-enoic acid.
What is the SMILES notation for nonyl 2-methylidenedodecanoate;prop-2-enoic acid?
The canonical SMILES for nonyl 2-methylidenedodecanoate;prop-2-enoic acid is C=C(CCCCCCCCCC)C(=O)OCCCCCCCCC.C=CC(=O)O.
What is the InChIKey of nonyl 2-methylidenedodecanoate;prop-2-enoic acid?
The InChIKey is WRKSERVONUTDJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H42O2.C3H4O2/c1-4-6-8-10-12-13-15-17-19-21(3)22(23)24-20-18-16-14-11-9-7-5-2;1-2-3(4)5/h3-20H2,1-2H3;2H,1H2,(H,4,5).
What are the key properties of nonyl 2-methylidenedodecanoate;prop-2-enoic acid?
nonyl 2-methylidenedodecanoate;prop-2-enoic acid has a molecular weight of 410.64 g/mol, XLogP of 7.62, 19 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nonyl 2-methylidenedodecanoate;prop-2-enoic acid is sourced from PubChem (CID 135390219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).