About butyl 2-methylidenedecanoate;nitrous acid
butyl 2-methylidenedecanoate;nitrous acid (PubChem CID 174807118) has the molecular formula C15H29NO4
and a molecular weight of 287.40 g/mol. Its IUPAC name is butyl 2-methylidenedecanoate;nitrous acid.
Molecular Properties
| Compound Name | butyl 2-methylidenedecanoate;nitrous acid |
| PubChem CID | 174807118 |
| Molecular Formula | C15H29NO4 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.21 |
| IUPAC Name | butyl 2-methylidenedecanoate;nitrous acid |
| SMILES | C=C(CCCCCCCC)C(=O)OCCCC.O=NO |
| InChI | InChI=1S/C15H28O2.HNO2/c1-4-6-8-9-10-11-12-14(3)15(16)17-13-7-5-2;2-1-3/h3-13H2,1-2H3;(H,2,3) |
| InChIKey | CJDZVPBMHFMMCM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 75.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze butyl 2-methylidenedecanoate;nitrous acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl 2-methylidenedecanoate;nitrous acid?
The IUPAC name of butyl 2-methylidenedecanoate;nitrous acid (CID 174807118) is butyl 2-methylidenedecanoate;nitrous acid.
What is the SMILES notation for butyl 2-methylidenedecanoate;nitrous acid?
The canonical SMILES for butyl 2-methylidenedecanoate;nitrous acid is C=C(CCCCCCCC)C(=O)OCCCC.O=NO.
What is the InChIKey of butyl 2-methylidenedecanoate;nitrous acid?
The InChIKey is CJDZVPBMHFMMCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O2.HNO2/c1-4-6-8-9-10-11-12-14(3)15(16)17-13-7-5-2;2-1-3/h3-13H2,1-2H3;(H,2,3).
What are the key properties of butyl 2-methylidenedecanoate;nitrous acid?
butyl 2-methylidenedecanoate;nitrous acid has a molecular weight of 287.40 g/mol, XLogP of 4.78, 11 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl 2-methylidenedecanoate;nitrous acid is sourced from PubChem (CID 174807118), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).