C19H35NO4 — CID 123486535
12-carbamoyloxyoctadec-9-enoic acid (PubChem CID 123486535) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is 12-carbamoyloxyoctadec-9-enoic acid.
| Compound Name | 12-carbamoyloxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 123486535 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | 12-carbamoyloxyoctadec-9-enoic acid |
| SMILES | CCCCCCC(CC=CCCCCCCCC(=O)O)OC(N)=O |
| InChI | InChI=1S/C19H35NO4/c1-2-3-4-11-14-17(24-19(20)23)15-12-9-7-5-6-8-10-13-16-18(21)22/h9,12,17H,2-8,10-11,13-16H2,1H3,(H2,20,23)(H,21,22) |
| InChIKey | PNXDHTWMJWOOPL-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|