C41H76O5 — CID 87208261
(Z,14R)-14-(14-hydroxyicos-11-enoyloxy)henicos-11-enoic acid (PubChem CID 87208261) has the molecular formula C41H76O5 and a molecular weight of 649.05 g/mol. Its IUPAC name is (Z,14R)-14-(14-hydroxyicos-11-enoyloxy)henicos-11-enoic acid.
| Compound Name | (Z,14R)-14-(14-hydroxyicos-11-enoyloxy)henicos-11-enoic acid |
|---|---|
| PubChem CID | 87208261 |
| Molecular Formula | C41H76O5 |
| Molecular Weight | 649.05 g/mol |
| Exact Mass | 648.57 |
| IUPAC Name | (Z,14R)-14-(14-hydroxyicos-11-enoyloxy)henicos-11-enoic acid |
| SMILES | CCCCCCC[C@H](C/C=C\CCCCCCCCCC(=O)O)OC(=O)CCCCCCCCCC=CCC(O)CCCCCC |
| InChI | InChI=1S/C41H76O5/c1-3-5-7-21-28-34-39(35-29-23-18-14-10-11-15-19-24-30-36-40(43)44)46-41(45)37-31-25-20-16-12-9-13-17-22-27-33-38(42)32-26-8-6-4-2/h22-23,27,29,38-39,42H,3-21,24-26,28,30-37H2,1-2H3,(H,43,44)/b27-22?,29-23-/t38?,39-/m1/s1 |
| InChIKey | IWTNAQGEUZLWRQ-SZJNXABOSA-N |
| XLogP | 12.59 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.05 |
| LogP ≤ 5 | 12.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|