C36H66O5 — CID 87110525
(Z,12R)-12-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxyoctadec-9-enoic acid (PubChem CID 87110525) has the molecular formula C36H66O5 and a molecular weight of 578.92 g/mol. Its IUPAC name is (Z,12R)-12-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxyoctadec-9-enoic acid.
| Compound Name | (Z,12R)-12-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxyoctadec-9-enoic acid |
|---|---|
| PubChem CID | 87110525 |
| Molecular Formula | C36H66O5 |
| Molecular Weight | 578.92 g/mol |
| Exact Mass | 578.49 |
| IUPAC Name | (Z,12R)-12-[(Z,12R)-12-hydroxyoctadec-9-enoyl]oxyoctadec-9-enoic acid |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O[C@@H](C/C=C\CCCCCCCC(=O)O)CCCCCC |
| InChI | InChI=1S/C36H66O5/c1-3-5-7-21-27-33(37)28-22-17-13-9-12-16-20-26-32-36(40)41-34(29-23-8-6-4-2)30-24-18-14-10-11-15-19-25-31-35(38)39/h17-18,22,24,33-34,37H,3-16,19-21,23,25-32H2,1-2H3,(H,38,39)/b22-17-,24-18-/t33-,34-/m1/s1 |
| InChIKey | BDQBCHRATGXQPP-LEMDDLEMSA-N |
| XLogP | 10.64 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.92 |
| LogP ≤ 5 | 10.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|