C28H50O6 — CID 87637964
(Z,12R)-12-(9-carboxynonanoyloxy)octadec-9-enoic acid (PubChem CID 87637964) has the molecular formula C28H50O6 and a molecular weight of 482.70 g/mol. Its IUPAC name is (Z,12R)-12-(9-carboxynonanoyloxy)octadec-9-enoic acid.
| Compound Name | (Z,12R)-12-(9-carboxynonanoyloxy)octadec-9-enoic acid |
|---|---|
| PubChem CID | 87637964 |
| Molecular Formula | C28H50O6 |
| Molecular Weight | 482.70 g/mol |
| Exact Mass | 482.36 |
| IUPAC Name | (Z,12R)-12-(9-carboxynonanoyloxy)octadec-9-enoic acid |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)O)OC(=O)CCCCCCCCC(=O)O |
| InChI | InChI=1S/C28H50O6/c1-2-3-4-15-20-25(21-16-11-7-5-6-8-12-17-22-26(29)30)34-28(33)24-19-14-10-9-13-18-23-27(31)32/h11,16,25H,2-10,12-15,17-24H2,1H3,(H,29,30)(H,31,32)/b16-11-/t25-/m1/s1 |
| InChIKey | FCUKIQXHCNIULR-XPXBXICFSA-N |
| XLogP | 7.84 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.70 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|