C25H46O4 — CID 172508929
methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate (PubChem CID 172508929) has the molecular formula C25H46O4 and a molecular weight of 410.64 g/mol. Its IUPAC name is methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate.
| Compound Name | methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate |
|---|---|
| PubChem CID | 172508929 |
| Molecular Formula | C25H46O4 |
| Molecular Weight | 410.64 g/mol |
| Exact Mass | 410.34 |
| IUPAC Name | methyl (Z,12R)-12-hexanoyloxyoctadec-9-enoate |
| SMILES | CCCCCC[C@H](C/C=C\CCCCCCCC(=O)OC)OC(=O)CCCCC |
| InChI | InChI=1S/C25H46O4/c1-4-6-8-16-19-23(29-25(27)22-15-7-5-2)20-17-13-11-9-10-12-14-18-21-24(26)28-3/h13,17,23H,4-12,14-16,18-22H2,1-3H3/b17-13-/t23-/m1/s1 |
| InChIKey | XPPKCKOVKRIAKQ-LQFJEPQRSA-N |
| XLogP | 7.30 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.64 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|