C28H55NO6 — CID 102485842
(Z)-N-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]octadec-9-enamide (PubChem CID 102485842) has the molecular formula C28H55NO6 and a molecular weight of 501.75 g/mol. Its IUPAC name is (Z)-N-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]octadec-9-enamide.
| Compound Name | (Z)-N-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]octadec-9-enamide |
|---|---|
| PubChem CID | 102485842 |
| Molecular Formula | C28H55NO6 |
| Molecular Weight | 501.75 g/mol |
| Exact Mass | 501.40 |
| IUPAC Name | (Z)-N-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethyl]octadec-9-enamide |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)NCCOCCOCCOCCOCCO |
| InChI | InChI=1S/C28H55NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-28(31)29-18-20-32-22-24-34-26-27-35-25-23-33-21-19-30/h9-10,30H,2-8,11-27H2,1H3,(H,29,31)/b10-9- |
| InChIKey | PICCNSLXPXUGTB-KTKRTIGZSA-N |
| XLogP | 5.20 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.75 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|