C27H48N2O5 — CID 171841485
(6Z,9Z,12Z)-N-[2-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethoxy]ethyl]octadeca-6,9,12-trienamide (PubChem CID 171841485) has the molecular formula C27H48N2O5 and a molecular weight of 480.69 g/mol. Its IUPAC name is (6Z,9Z,12Z)-N-[2-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethoxy]ethyl]octadeca-6,9,12-trienamide.
| Compound Name | (6Z,9Z,12Z)-N-[2-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethoxy]ethyl]octadeca-6,9,12-trienamide |
|---|---|
| PubChem CID | 171841485 |
| Molecular Formula | C27H48N2O5 |
| Molecular Weight | 480.69 g/mol |
| Exact Mass | 480.36 |
| IUPAC Name | (6Z,9Z,12Z)-N-[2-[2-[2-(3-amino-3-oxopropoxy)ethoxy]ethoxy]ethyl]octadeca-6,9,12-trienamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\CCCCC(=O)NCCOCCOCCOCCC(N)=O |
| InChI | InChI=1S/C27H48N2O5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-27(31)29-19-21-33-23-25-34-24-22-32-20-18-26(28)30/h6-7,9-10,12-13H,2-5,8,11,14-25H2,1H3,(H2,28,30)(H,29,31)/b7-6-,10-9-,13-12- |
| InChIKey | LKRNRUQCMUACSU-QNEBEIHSSA-N |
| XLogP | 4.62 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.69 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|